Gardenin D structure
|
Common Name | Gardenin D | ||
|---|---|---|---|---|
| CAS Number | 29202-00-4 | Molecular Weight | 374.34 | |
| Density | 1.375g/cm3 | Boiling Point | 631.6ºC at 760 mmHg | |
| Molecular Formula | C19H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8ºC | |
Use of Gardenin DGardenin D is a natural product. Gardenin D can be isolated from the leaves of Isodon rubescens var. lushiensis[1]. |
| Name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,7,8-trimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Gardenin D is a natural product. Gardenin D can be isolated from the leaves of Isodon rubescens var. lushiensis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 631.6ºC at 760 mmHg |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.34 |
| Flash Point | 228.8ºC |
| Exact Mass | 374.10000 |
| PSA | 107.59000 |
| LogP | 2.90560 |
| Vapour Pressure | 1.51E-16mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | DQMSOZCDDAULPH-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc1O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,3'-Dihydroxy-6,7,8,4'-tetramethoxyflavone |
| 3',5-dihydroxy-4',6,7,8-tetramethoxyflavone |
| 5,4'-dihydroxy-6,7,8,3'-tetramethoxyflavone |
| Gardenin D |
| Flavone,3',5-dihydroxy-4',6,7,8-tetramethoxy |