Hydantoic acid
Modify Date: 2025-08-25 17:13:56
Hydantoic acid structure
|
Common Name | Hydantoic acid | ||
|---|---|---|---|---|
| CAS Number | 28861-00-9 | Molecular Weight | 282.29200 | |
| Density | 1.26 g/cm3 | Boiling Point | 463.481ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-(carbamoylamino)-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26 g/cm3 |
|---|---|
| Boiling Point | 463.481ºC at 760 mmHg |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.29200 |
| Exact Mass | 282.12200 |
| PSA | 110.88000 |
| LogP | 1.84910 |
| Index of Refraction | 1.553 |
| InChIKey | ZAWWRCDFZPMIQT-ZDUSSCGKSA-N |
| SMILES | COc1ccc(CC(C)(NC(N)=O)C(=O)O)cc1OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| RTECS | MB7660000 |
| HS Code | 2924210090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (S)-3-(3,4-dimethoxyphenyl)-2-methyl-2-ureidopropanoic acid |
| (s)-2-(aminocarbonyl)-amino-3-(3,4-dimethoxyphenyl)-2-methylpropanoic acid |
| MFCD00047876 |