ER-Tracker Blue-White DPX structure
|
Common Name | ER-Tracker Blue-White DPX | ||
|---|---|---|---|---|
| CAS Number | 287715-95-1 | Molecular Weight | 580.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H21F5N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ER-Tracker Blue-White DPXER-Tracker Blue-White DPX is a photostable probe used to selectively label the endoplasmic reticulum for fluorescence microscopy imaging[1]. |
| Name | ER-Tracker Blue-White DPX |
|---|
| Description | ER-Tracker Blue-White DPX is a photostable probe used to selectively label the endoplasmic reticulum for fluorescence microscopy imaging[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H21F5N4O4S |
|---|---|
| Molecular Weight | 580.53 |
| InChIKey | JMJKKMLLEHNELP-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2cnc(-c3ccc(S(=O)(=O)NCCNC(=O)c4c(F)c(F)c(F)c(F)c4F)cc3)o2)cc1 |