2-Chloro-1-(8-methyl-1,2,3a,4,5,6-hexahydro-pyrazino[3,2,1-jk]carbazol-3-yl)-ethanone structure
|
Common Name | 2-Chloro-1-(8-methyl-1,2,3a,4,5,6-hexahydro-pyrazino[3,2,1-jk]carbazol-3-yl)-ethanone | ||
|---|---|---|---|---|
| CAS Number | 28742-49-6 | Molecular Weight | 302.79900 | |
| Density | 1.37g/cm3 | Boiling Point | 534.7ºC at 760mmHg | |
| Molecular Formula | C17H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.2ºC | |
| Name | 2-Chloro-1-(8-methyl-1,2,3a,4,5,6-hexahydro-pyrazino[3,2,1-jk]carbazol-3-yl)-ethanone |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 534.7ºC at 760mmHg |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.79900 |
| Flash Point | 277.2ºC |
| Exact Mass | 302.11900 |
| PSA | 25.24000 |
| LogP | 3.34600 |
| Vapour Pressure | 1.65E-11mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | GFAMGQKPRPMKPF-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(C(=O)CCl)C3CCC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |