6-PHENYL-4-PYRIMIDINECARBOXYLIC ACID structure
|
Common Name | 6-PHENYL-4-PYRIMIDINECARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 28668-32-8 | Molecular Weight | 200.19300 | |
| Density | 1.302g/cm3 | Boiling Point | 440.6ºC at 760 mmHg | |
| Molecular Formula | C11H8N2O2 | Melting Point | 173-177ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 220.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-phenylpyrimidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 440.6ºC at 760 mmHg |
| Melting Point | 173-177ºC(lit.) |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.19300 |
| Flash Point | 220.3ºC |
| Exact Mass | 200.05900 |
| PSA | 63.08000 |
| LogP | 1.84180 |
| Vapour Pressure | 1.54E-08mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | WPZVBDSJGHLIMS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2)ncn1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~%
6-PHENYL-4-PYRI... CAS#:28668-32-8 |
| Literature: Sakamoto; Sakasai; Yamanaka Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 2 p. 571 - 577 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Phenyl-4-pyrimidinecarboxylic acid |
| MFCD06200701 |
| 6-Phenylpyrimidin-4-carbonsaeure |
| 6-Phenylpyrimidine-4-carboxylicacid |
| 4-Pyrimidinecarboxylicacid,6-phenyl |