1,3-Diisopropylimidazolium tetrafluoroborate
Modify Date: 2025-08-25 11:44:16
1,3-Diisopropylimidazolium tetrafluoroborate structure
|
Common Name | 1,3-Diisopropylimidazolium tetrafluoroborate | ||
|---|---|---|---|---|
| CAS Number | 286014-34-4 | Molecular Weight | 240.049 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17BF4N2 | Melting Point | 62-79ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,3-di(propan-2-yl)imidazol-1-ium,tetrafluoroborate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 62-79ºC |
|---|---|
| Molecular Formula | C9H17BF4N2 |
| Molecular Weight | 240.049 |
| Exact Mass | 240.142090 |
| PSA | 8.81000 |
| LogP | 3.23740 |
| InChIKey | PSKQPXYUPOKHPY-UHFFFAOYSA-N |
| SMILES | CC(C)n1cc[n+](C(C)C)c1.F[B-](F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Diisopropyl-1H-imidazol-3-ium tetrafluoroborate |
| 1,3-Diisopropylimidazolium tetrafluoroborate |
| IiPr.HBF4 |
| MFCD08276804 |