Acetic acid,2-(octylsulfonyl)-, ethyl ester
Modify Date: 2025-08-25 17:40:03
Acetic acid,2-(octylsulfonyl)-, ethyl ester structure
|
Common Name | Acetic acid,2-(octylsulfonyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2850-20-6 | Molecular Weight | 264.38200 | |
| Density | 1.052g/cm3 | Boiling Point | 394ºC at 760 mmHg | |
| Molecular Formula | C12H24O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | 2-octyl tetrahydropyran-2-yl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 394ºC at 760 mmHg |
| Molecular Formula | C12H24O4S |
| Molecular Weight | 264.38200 |
| Flash Point | 192.1ºC |
| Exact Mass | 264.14000 |
| PSA | 68.82000 |
| LogP | 3.40560 |
| Vapour Pressure | 2.05E-06mmHg at 25°C |
| Index of Refraction | 1.456 |
| InChIKey | JPPQYLGGDPDQCV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCS(=O)(=O)CC(=O)OCC |
|
~%
Acetic acid,2-(... CAS#:2850-20-6 |
| Literature: van Leusen,A.M.; Strating,J. Recueil des Travaux Chimiques des Pays-Bas, 1965 , vol. 84, p. 140 - 150 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-tetrahydropyranyl ether of 2-octanol |
| THP ether of 2-octanol |
| Aethyl-n-octylsulfonylacetat |
| 2-tetrahydropyranyloxyoctane |