mecoprop-2-octyl ester
Modify Date: 2025-08-20 23:51:57
mecoprop-2-octyl ester structure
|
Common Name | mecoprop-2-octyl ester | ||
|---|---|---|---|---|
| CAS Number | 28473-03-2 | Molecular Weight | 326.85800 | |
| Density | 1.051g/cm3 | Boiling Point | 397.1ºC at 760mmHg | |
| Molecular Formula | C18H27ClO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 130.4ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | octan-2-yl 2-(4-chloro-2-methylphenoxy)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.051g/cm3 |
|---|---|
| Boiling Point | 397.1ºC at 760mmHg |
| Molecular Formula | C18H27ClO3 |
| Molecular Weight | 326.85800 |
| Flash Point | 130.4ºC |
| Exact Mass | 326.16500 |
| PSA | 35.53000 |
| LogP | 5.31780 |
| Vapour Pressure | 1.63E-06mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | QSERAAUJOZXWGA-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1OC(C)C(=O)OCCCCCC(C)C |
CHEMICAL IDENTIFICATION
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H400 |
| Precautionary Statements | P273-P280 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | 22-43-50/53 |
| Safety Phrases | 13-36/37-60-61 |
| RIDADR | UN3082 9/PG 3 |
| RTECS | UA2455000 |
| 2-(2-Methyl-4-chlorophenoxy)propionic acid,isooctyl ester |
| Mecoprop-isoctyl |
| Mecoprop-2-octyl ester |
| Propionic acid,2-((4-chloro-o-tolyl)oxy)-,isooctyl ester |
| Caswell No. 559C |
| Isooctyl 2-(2-methyl-4-chlorophenoxy)propionate |
| EINECS 249-046-5 |
| Mecoprop-isoctyl [ISO] |
| Isooctyl 2-(4-chloro-2-methylphenoxy)propionate |