2,6-di-iso-propylphenyl isocyanate structure
|
Common Name | 2,6-di-iso-propylphenyl isocyanate | ||
|---|---|---|---|---|
| CAS Number | 28178-42-9 | Molecular Weight | 203.280 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 247.2±0.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 107.2±0.0 °C | |
| Symbol |
GHS05, GHS06, GHS08 |
Signal Word | Danger | |
| Name | 2-isocyanato-1,3-di(propan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 247.2±0.0 °C at 760 mmHg |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.280 |
| Flash Point | 107.2±0.0 °C |
| Exact Mass | 203.131012 |
| PSA | 29.43000 |
| LogP | 5.26 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | FEUFNKALUGDEMQ-UHFFFAOYSA-N |
| SMILES | CC(C)c1cccc(C(C)C)c1N=C=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H317-H318-H330-H334-H335 |
| Precautionary Statements | P260-P280-P284-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T+:Verytoxic; |
| Risk Phrases | R21/22;R26;R36/37/38 |
| Safety Phrases | S23-S26-S36/37/39-S45-S28A |
| RIDADR | UN 3382 6.1/PG 1 |
| WGK Germany | 2 |
| RTECS | CY8545000 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 2929109000 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2929109000 |
|---|---|
| Summary | 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Multiple bonds between transition metals and main-group elements. 72. Organorhenium imido complexes: syntheses, structure, and reactivity. Herrmann WA, et al.
Organometallics 9(2) , 489-96, (1990)
|
|
|
Reactions of unsaturated electrophiles with trans-(PMe3)2 Pd (Ph)(NHPh). Boncella JM and Villanueva LA.
J. Organomet. Chem. 465(1) , 297-304, (1994)
|
|
|
A new protocol for rotaxane synthesis. Cantrill SJ, et al.
Tetrahedron Lett. 40(19) , 3669-72, (1999)
|
| Benzene,2-isocyanato-1,3-bis(1-methylethyl) |
| 2,5-DIHYDRO-5-OXO-1-PHENYL-1H-1,2,4-TRIAZOLE-3-CARBOXYLIC ACID PHENYLAMIDE |
| Isocyanic Acid 2,6-Diisopropylphenyl Ester |
| 2-isocyanato-1,3-di(propan-2-yl)benzene |
| 2,6-(i-Pr)2PhNCO |
| 2,6-di-iso-propylphenyl isocyanate |
| Benzene, 2-isocyanato-1,3-bis(1-methylethyl)- |
| o,o'-Diisopropylphenyl isocyanate |
| 2-Isocyanato-1,3-diisopropylbenzene |
| 2,6-Diisopropylphenyl Isocyanate |
| EINECS 248-885-4 |
| 2,6-Bis(1-methylethyl)phenyl isocyanate |
| MFCD00008882 |