ETHYL 5H-OCTAFLUOROPENTANOATE structure
|
Common Name | ETHYL 5H-OCTAFLUOROPENTANOATE | ||
|---|---|---|---|---|
| CAS Number | 2795-50-8 | Molecular Weight | 274.10900 | |
| Density | 1.43g/cm3 | Boiling Point | 141.2ºC at 760mmHg | |
| Molecular Formula | C7H6F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 38.9ºC | |
| Name | ethyl 2,2,3,3,4,4,5,5-octafluoropentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 141.2ºC at 760mmHg |
| Molecular Formula | C7H6F8O2 |
| Molecular Weight | 274.10900 |
| Flash Point | 38.9ºC |
| Exact Mass | 274.02400 |
| PSA | 26.30000 |
| LogP | 2.72050 |
| Index of Refraction | 1.326 |
| InChIKey | HXWMNJVBQLBDGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|---|
| Safety Phrases | 23-24/25 |
| RIDADR | 3272.0 |
| Hazard Class | 3.0 |
| HS Code | 2915900090 |
|
~%
ETHYL 5H-OCTAFL... CAS#:2795-50-8 |
| Literature: Kim,Y.K. Journal of Organic Chemistry, 1967 , vol. 32, p. 3673 - 3675 |
|
~%
ETHYL 5H-OCTAFL... CAS#:2795-50-8 |
| Literature: Kim,Y.K. Journal of Organic Chemistry, 1967 , vol. 32, p. 3673 - 3675 |
|
~%
ETHYL 5H-OCTAFL... CAS#:2795-50-8 |
| Literature: McBee; Wiseman; Bachman Industrial and Engineering Chemistry, 1947 , vol. 39, p. 415,416 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| PC3260A |
| Ethyl 5H-Octafluorovalerate |
| 5H-octafluoro-valeric acid ethyl ester |
| 2,2,3,3,4,4,5,5-octafluoropentanoic acid ethyl ester |
| 5H-Octafluor-valeriansaeure-aethylester |
| Ethyl 5H-perfluoropentanoate |