BCP-T.A
Modify Date: 2024-04-05 18:12:41
BCP-T.A structure
|
Common Name | BCP-T.A | ||
|---|---|---|---|---|
| CAS Number | 2786829-70-5 | Molecular Weight | 456.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H19Cl2N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BCP-T.ABCP-T.A, a tunable heterocyclic electrophile, is a potent ferroptosis inducer by binding to GPX4[1]. |
| Name | BCP-T.A |
|---|
| Description | BCP-T.A, a tunable heterocyclic electrophile, is a potent ferroptosis inducer by binding to GPX4[1]. |
|---|---|
| Related Catalog | |
| Target |
GPX4[1] |
| In Vitro | BCP-T.A induces ferroptosis in various cell lines (NCI-H522, T-1080, MDA-MB-468, MDA-MB-231, HeLa, HCT-116, U2OS, WI-38, and MEFS) with IC50 values of 10 nM-367 nM[1]. BCP-T.A (0.5 μM, 3 h) binds to GPX4 and increases lipid peroxides, indicated by cellular thermal shift assay (CETSA)[1]. |
| References |
| Molecular Formula | C23H19Cl2N3OS |
|---|---|
| Molecular Weight | 456.39 |
| InChIKey | XWHYWEHRTWXUFV-UHFFFAOYSA-N |
| SMILES | C#Cc1nc(C(=O)N2CCN(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)CC2)cs1 |