2-Anthracenesulfonicacid, 1-amino-9,10-dihydro-9,10-dioxo-4-(phenylamino)- structure
|
Common Name | 2-Anthracenesulfonicacid, 1-amino-9,10-dihydro-9,10-dioxo-4-(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 2786-71-2 | Molecular Weight | 394.40100 | |
| Density | 1.576g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-4-anilino-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.576g/cm3 |
|---|---|
| Molecular Formula | C20H14N2O5S |
| Molecular Weight | 394.40100 |
| Exact Mass | 394.06200 |
| PSA | 134.94000 |
| LogP | 4.76950 |
| Index of Refraction | 1.743 |
| InChIKey | OPBOOIFXQHPAPJ-UHFFFAOYSA-N |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
2-Anthracenesul... CAS#:2786-71-2 |
| Literature: Bessubez; Rosina Zhurnal Prikladnoi Khimii (Sankt-Peterburg, Russian Federation), 1948 , vol. 21, p. 1152,1158 Chem. Zentralbl., 1949 , vol. 120, p. 6193 |
|
~%
2-Anthracenesul... CAS#:2786-71-2 |
| Literature: Naik, N. M.; Desai, K. R. Journal of the Indian Chemical Society, 1987 , vol. 64, p. 760 - 761 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Amino-9,10-dihydro-9,10-dioxo-4-(phenylamino)-2-anthracenesulfonic acid |
| 2-Anthracenesulfonic acid,1-amino-9,10-dihydro-9,10-dioxo-4-(phenylamino) |
| 1-Amino-4-anilino-anthrachinon-sulfonsaeure-(2) |
| 1-amino-4-anilinoanthraquinone-2-sulphonic acid |
| EINECS 220-508-8 |
| Alizarinsaphirol A |
| 1-Amino-4-anilino-9,10-dioxo-9,10-dihydro-anthracen-2-sulfonsaeure |
| C.I. Acid Blue 25 free acid |
| 1-amino-4-phenylaminoanthraquinone-2-sulfonic acid |
| 1-amino-4-anilino-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonic acid |
| C.I. ACID BLUE 25 |