(-)-Hydroxycitric acid
Modify Date: 2025-08-26 13:03:59
(-)-Hydroxycitric acid structure
|
Common Name | (-)-Hydroxycitric acid | ||
|---|---|---|---|---|
| CAS Number | 27750-10-3 | Molecular Weight | 530.43200 | |
| Density | 1.947g/cm3 | Boiling Point | 393.3ºC at 760mmHg | |
| Molecular Formula | C6H8O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.8ºC | |
Use of (-)-Hydroxycitric acid(-)-Hydroxycitric acid (Garcinia acid) is the principal acid of fruit rinds of Garcinia cambogia. (-)-Hydroxycitric acid is a potent and competitive inhibitor of ATP citrate lyase. (-)-Hydroxycitric acid suppresses the fatty acid synthesis, lipogenesis, food intake, and induced weight loss[1][2]. |
| Name | (-)-hydroxycitric acid calcium salt |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Hydroxycitric acid (Garcinia acid) is the principal acid of fruit rinds of Garcinia cambogia. (-)-Hydroxycitric acid is a potent and competitive inhibitor of ATP citrate lyase. (-)-Hydroxycitric acid suppresses the fatty acid synthesis, lipogenesis, food intake, and induced weight loss[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.947g/cm3 |
|---|---|
| Boiling Point | 393.3ºC at 760mmHg |
| Molecular Formula | C6H8O8 |
| Molecular Weight | 530.43200 |
| Flash Point | 205.8ºC |
| Exact Mass | 529.88500 |
| PSA | 238.72000 |
| Vapour Pressure | 8.17E-08mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | ZMJBYMUCKBYSCP-CVYQJGLWSA-N |
| SMILES | O=C(O)CC(O)(C(=O)O)C(O)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-Hydroxyindo |
| hydroxy citric acid |
| Garciniasaeure |
| HYDROXYCITRATE |
| SUPERCITRIMAX |