FMF-06-098-1
Modify Date: 2025-09-18 12:16:12
FMF-06-098-1 structure
|
Common Name | FMF-06-098-1 | ||
|---|---|---|---|---|
| CAS Number | 2769753-07-1 | Molecular Weight | 1073.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C53H69ClN10O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FMF-06-098-1FMF-06-098-1 is a highly multitargeted depressant. FMF-06-098-1 can be used to target degradation kinases which degrades AAK1, AΒL2, AURKA, AURKB, BUBIB, CDC7, CDK1, CDK12, CDK13, CDK2, CDK4, CDk6, CDK7, CDK9, CHEK1, CSNKID, EPHA1, PER, FGFR1, GAK, IRAK4, ITK, LIMK2, MAP4K2, MAP4K3, MAPK6, MAPK7, MARK4, MELK, PKN3, PLK4, PRKAA1, PTK2, PTK6, RPS6KA4, S1K2, STK35, TNK2, UHMK1, ULK1, and WEE1[1]. |
| Name | FMF-06-098-1 |
|---|
| Description | FMF-06-098-1 is a highly multitargeted depressant. FMF-06-098-1 can be used to target degradation kinases which degrades AAK1, AΒL2, AURKA, AURKB, BUBIB, CDC7, CDK1, CDK12, CDK13, CDK2, CDK4, CDk6, CDK7, CDK9, CHEK1, CSNKID, EPHA1, PER, FGFR1, GAK, IRAK4, ITK, LIMK2, MAP4K2, MAP4K3, MAPK6, MAPK7, MARK4, MELK, PKN3, PLK4, PRKAA1, PTK2, PTK6, RPS6KA4, S1K2, STK35, TNK2, UHMK1, ULK1, and WEE1[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C53H69ClN10O8S2 |
|---|---|
| Molecular Weight | 1073.76 |
| InChIKey | KRCGDZOGRHISNJ-NQGAHEFWSA-N |
| SMILES | Cc1ncsc1-c1ccc(C(C)NC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCOCCOCCN2CCN(c3ccc(Nc4ncc(Cl)c(Nc5ccccc5S(=O)(=O)C(C)C)n4)cc3)CC2)C(C)(C)C)cc1 |