CD73-IN-6 structure
|
Common Name | CD73-IN-6 | ||
|---|---|---|---|---|
| CAS Number | 2757808-96-9 | Molecular Weight | 385.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15N7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CD73-IN-6CD73-IN-6 is a CD73 inhibitor extracted from patent WO2022007677A1 compound 2. CD73-IN-6 can be used for the research of cancer[1]. |
| Name | CD73-IN-6 |
|---|
| Description | CD73-IN-6 is a CD73 inhibitor extracted from patent WO2022007677A1 compound 2. CD73-IN-6 can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
CD73[1] |
| References |
[1]. Wu, et, al. Cd73 inhibitor and application in pharmaceutical use. WO2022007677A1. |
| Molecular Formula | C20H15N7O2 |
|---|---|
| Molecular Weight | 385.38 |
| InChIKey | ICMVFAXBUDSHPS-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-c2c[nH]c(=O)[nH]c2=O)cc1-c1ccn(Cc2ccc(C#N)cc2)n1 |