p-phenylenebis(dimethylsilanol) structure
|
Common Name | p-phenylenebis(dimethylsilanol) | ||
|---|---|---|---|---|
| CAS Number | 2754-32-7 | Molecular Weight | 226.420 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 289.6±36.0 °C at 760 mmHg | |
| Molecular Formula | C10H18O2Si2 | Melting Point | 133-136 °C(lit.) | |
| MSDS | N/A | Flash Point | 129.0±26.2 °C | |
| Name | hydroxy-[4-[hydroxy(dimethyl)silyl]phenyl]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.6±36.0 °C at 760 mmHg |
| Melting Point | 133-136 °C(lit.) |
| Molecular Formula | C10H18O2Si2 |
| Molecular Weight | 226.420 |
| Flash Point | 129.0±26.2 °C |
| Exact Mass | 226.084534 |
| PSA | 40.46000 |
| LogP | 3.36 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | YBNBOGKRCOCJHH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(O)c1ccc([Si](C)(C)O)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| p-bis(dimethyl-hydroxi-silil)benzene-d0 |
| p-phenylenebis(dimethylsilanol) |
| Silanol, 1,1'-(1,4-phenylene)bis[1,1-dimethyl- |
| Silanol, p-phenylenebis[dimethyl- |
| 1,4-bis(hydroxydimethylsilyl) benzene |
| p-Bis(dimethylhydroxysilyl)benzene |
| 1,4-Bis(dimethylhydroxysilyl)benzene |
| tetra-Si-methyl-Si,Si'-p-phenylene-bis-silanol |
| EINECS 220-405-8 |
| MFCD00039516 |
| Tetra-Si-methyl-Si,Si'-p-phenylen-bis-silanol |
| AMTSi068 |
| 1,4-bis-(dimethyloxysilyl)-benzene |
| 1,4-Phenylenebis(dimethylsilanol) |
| SILANOL, 1,4-PHENYLENEBIS(DIMETHYL- |
| dimethyl-(4-dimethylhydroxysilyl)phenylsilanol |