4-Methoxyaniline-2,5-disulfonic acid
Modify Date: 2025-08-25 17:41:44
4-Methoxyaniline-2,5-disulfonic acid structure
|
Common Name | 4-Methoxyaniline-2,5-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 27327-48-6 | Molecular Weight | 283.27900 | |
| Density | 1.757 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Amino-5-methoxybenzene-1,4-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.757 g/cm3 |
|---|---|
| Molecular Formula | C7H9NO7S2 |
| Molecular Weight | 283.27900 |
| Exact Mass | 282.98200 |
| PSA | 160.75000 |
| LogP | 2.51360 |
| Index of Refraction | 1.631 |
| InChIKey | GLABVBIYGGDCNO-UHFFFAOYSA-N |
| SMILES | COc1cc(S(=O)(=O)O)c(N)cc1S(=O)(=O)O |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Methoxyaniline-2,5-disulfonic acid |
| MFCD00797926 |
| p-anisidine-2,5-disulfonic acid |