β-Rubromycin
Modify Date: 2025-08-25 13:25:18
β-Rubromycin structure
|
Common Name | β-Rubromycin | ||
|---|---|---|---|---|
| CAS Number | 27267-70-5 | Molecular Weight | 536.44000 | |
| Density | 1.67g/cm3 | Boiling Point | 874.8ºC at 760mmHg | |
| Molecular Formula | C27H20O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.9ºC | |
Use of β-Rubromycinβ-Rubromycin is a potent and selective inhibitor of human immunodeficiency virus-1 (HIV-1) RNA-directed DNA polymeras (reverse transcriptase). β-Rubromycin is a class of quinone antibacterials[1]. |
| Name | methyl (2S)-8',10-dihydroxy-5',7'-dimethoxy-4',9,9'-trioxospiro[3,4-dihydropyrano[4,3-g]chromene-2,2'-3H-benzo[f][1]benzofuran]-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | β-Rubromycin is a potent and selective inhibitor of human immunodeficiency virus-1 (HIV-1) RNA-directed DNA polymeras (reverse transcriptase). β-Rubromycin is a class of quinone antibacterials[1]. |
|---|---|
| Related Catalog | |
| Target |
reverse transcriptase[1] |
| References |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 874.8ºC at 760mmHg |
| Molecular Formula | C27H20O12 |
| Molecular Weight | 536.44000 |
| Flash Point | 298.9ºC |
| Exact Mass | 536.09500 |
| PSA | 168.03000 |
| LogP | 2.78290 |
| Vapour Pressure | 2.92E-32mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | FXCBZGHGMRSWJD-MHZLTWQESA-N |
| SMILES | COC(=O)c1cc2cc3c(c(O)c2c(=O)o1)OC1(CC3)CC2=C(O1)C(=O)c1c(O)c(OC)cc(OC)c1C2=O |
| tunicamycin VIII |
| TUNICAMYCIN C2 HOMOLOG |