Benzenebutanoic acid,4-[(2-chloroethyl)(2-hydroxyethyl)amino]- structure
|
Common Name | Benzenebutanoic acid,4-[(2-chloroethyl)(2-hydroxyethyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 27171-89-7 | Molecular Weight | 285.76700 | |
| Density | 1.243g/cm3 | Boiling Point | 480.3ºC at 760 mmHg | |
| Molecular Formula | C14H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.3ºC | |
| Name | 4-[4-[2-chloroethyl(2-hydroxyethyl)amino]phenyl]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 480.3ºC at 760 mmHg |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.76700 |
| Flash Point | 244.3ºC |
| Exact Mass | 285.11300 |
| PSA | 60.77000 |
| LogP | 2.13140 |
| Vapour Pressure | 4.89E-10mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | SFCORMODVLBZLW-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCc1ccc(N(CCO)CCCl)cc1 |
|
~%
Benzenebutanoic... CAS#:27171-89-7 |
| Literature: Ehrsson; Eksborg; Wallin; Nilsson Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 9 p. 1091 - 1094 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-[p-(2-chloroethyl-2-hydroxyethylamino)phenyl]butyric acid |
| 4-{4-[(2-chloroethyl)(2-hydroxyethyl)amino]phenyl}butanoic acid |