ethyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate structure
|
Common Name | ethyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate | ||
|---|---|---|---|---|
| CAS Number | 27143-09-5 | Molecular Weight | 261.105 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 337.1±44.0 °C at 760 mmHg | |
| Molecular Formula | C10H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.7±28.4 °C | |
| Name | ethyl 2-chloro-2-[(4-chlorophenyl)hydrazinylidene]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.1±44.0 °C at 760 mmHg |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.105 |
| Flash Point | 157.7±28.4 °C |
| Exact Mass | 260.011932 |
| PSA | 50.69000 |
| LogP | 4.21 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | DDJOIKUARWSPEQ-ZROIWOOFSA-N |
| SMILES | CCOC(=O)C(Cl)=NNc1ccc(Cl)cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Ethyl (2Z)-chloro[(4-chlorophenyl)hydrazono]acetate |
| Acetic acid, 2-chloro-2-[2-(4-chlorophenyl)hydrazinylidene]-, ethyl ester, (2E)- |
| Ethyl (2E)-chloro[(4-chlorophenyl)hydrazono]acetate |
| Acetic acid, 2-chloro-2-[2-(4-chlorophenyl)hydrazinylidene]-, ethyl ester, (2Z)- |