ethyl 2-chloro-2-[[2-(trifluoromethyl)phenyl]hydrazinylidene]acetate
Modify Date: 2025-10-11 12:10:13
![ethyl 2-chloro-2-[[2-(trifluoromethyl)phenyl]hydrazinylidene]acetate Structure](https://image.chemsrc.com/caspic/423/35229-86-8.png)
ethyl 2-chloro-2-[[2-(trifluoromethyl)phenyl]hydrazinylidene]acetate structure
|
Common Name | ethyl 2-chloro-2-[[2-(trifluoromethyl)phenyl]hydrazinylidene]acetate | ||
|---|---|---|---|---|
| CAS Number | 35229-86-8 | Molecular Weight | 294.65800 | |
| Density | 1.358g/cm3 | Boiling Point | 316.548ºC at 760 mmHg | |
| Molecular Formula | C11H10ClF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.243ºC | |
| Name | ethyl 2-chloro-2-[[2-(trifluoromethyl)phenyl]hydrazinylidene]acetate |
|---|
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 316.548ºC at 760 mmHg |
| Molecular Formula | C11H10ClF3N2O2 |
| Molecular Weight | 294.65800 |
| Flash Point | 145.243ºC |
| Exact Mass | 294.03800 |
| PSA | 50.69000 |
| LogP | 3.30570 |
| Index of Refraction | 1.498 |
| InChIKey | KOTWSMZTIFTQHU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)=NNc1ccccc1C(F)(F)F |
| HS Code | 2928000090 |
|---|
|
~%
ethyl 2-chloro-... CAS#:35229-86-8 |
| Literature: Cocco; Maccioni; Plumitallo Farmaco, Edizione Scientifica, 1985 , vol. 40, # 4 p. 272 - 284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |