1-(3,4-DICHLOROPHENYL)-1-TOSYLMETHYLISOCYANIDE
Modify Date: 2025-08-22 12:11:42
1-(3,4-DICHLOROPHENYL)-1-TOSYLMETHYLISOCYANIDE structure
|
Common Name | 1-(3,4-DICHLOROPHENYL)-1-TOSYLMETHYLISOCYANIDE | ||
|---|---|---|---|---|
| CAS Number | 2712-68-7 | Molecular Weight | 285.047 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 338.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H5Cl2F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3±27.9 °C | |
| Name | 1-(3,4-dichlorophenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.1±42.0 °C at 760 mmHg |
| Molecular Formula | C10H5Cl2F3O2 |
| Molecular Weight | 285.047 |
| Flash Point | 158.3±27.9 °C |
| Exact Mass | 283.961884 |
| PSA | 34.14000 |
| LogP | 5.57 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | XAYCIVPYZDVHJM-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2914700090 |
|---|
|
~%
1-(3,4-DICHLORO... CAS#:2712-68-7 |
| Literature: Wang, Ning-Yu; Zuo, Wei-Qiong; Xu, Ying; Gao, Chao; Zeng, Xiu-Xiu; Zhang, Li-Dan; You, Xin-Yu; Peng, Cui-Ting; Shen, Yang; Yang, Sheng-Yong; Wei, Yu-Quan; Yu, Luo-Ting Bioorganic and Medicinal Chemistry Letters, 2014 , vol. 24, # 6 p. 1581 - 1588 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(3,4-Dichlorophenyl)-4,4,4-trifluoro-1,3-butanedione |
| 4-(3',4'-Dichlorophenyl)-1,1,1-trifluorobutane-2,4-dione |
| 1,3-Butanedione, 1-(3,4-dichlorophenyl)-4,4,4-trifluoro- |
| 1-(3,4-dichloro-phenyl)-4,4,4-trifluoro-butane-1,3-dione |
| 1-(3,4-dichlorophenyl)-4,4,4-trifluorobutane-1,3-dione |