1-(3,4-dichlorophenyl)-1-ethylsulfanyl-nonan-3-one
Modify Date: 2025-08-26 15:37:47
1-(3,4-dichlorophenyl)-1-ethylsulfanyl-nonan-3-one structure
|
Common Name | 1-(3,4-dichlorophenyl)-1-ethylsulfanyl-nonan-3-one | ||
|---|---|---|---|---|
| CAS Number | 77921-30-3 | Molecular Weight | 347.34300 | |
| Density | 1.133g/cm3 | Boiling Point | 432.2ºC at 760 mmHg | |
| Molecular Formula | C17H24Cl2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.2ºC | |
| Name | 1-(3,4-dichlorophenyl)-1-ethylsulfanylnonan-3-one |
|---|
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 432.2ºC at 760 mmHg |
| Molecular Formula | C17H24Cl2OS |
| Molecular Weight | 347.34300 |
| Flash Point | 215.2ºC |
| Exact Mass | 346.09200 |
| PSA | 42.37000 |
| LogP | 6.71720 |
| Index of Refraction | 1.534 |
| InChIKey | VXWJKTZQAZJIIQ-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)CC(SCC)c1ccc(Cl)c(Cl)c1 |
|
~%
1-(3,4-dichloro... CAS#:77921-30-3 |
| Literature: Dimmock, J.R.; Smith, L.M.; Smith, P.J. Canadian Journal of Chemistry, 1980 , vol. 58, p. 984 - 991 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |