16-acetoxy-7-o-acetylhorminone structure
|
Common Name | 16-acetoxy-7-o-acetylhorminone | ||
|---|---|---|---|---|
| CAS Number | 269742-39-4 | Molecular Weight | 432.507 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 534.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H32O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.4±23.6 °C | |
Use of 16-acetoxy-7-o-acetylhorminone16-Acetoxy-7-O-acetylhorminone is a compound isolated from the leaves of Rabdosia lophanthoides var. gerardiana[1]. |
| Name | (7α)-12-Hydroxy-11,14-dioxoabieta-8,12-diene-7,16-diyl diacetate |
|---|---|
| Synonym | More Synonyms |
| Description | 16-Acetoxy-7-O-acetylhorminone is a compound isolated from the leaves of Rabdosia lophanthoides var. gerardiana[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. XuYunlong, et al. Abietane quinones from Rabdosia lophanthoides. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 534.0±50.0 °C at 760 mmHg |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.507 |
| Flash Point | 174.4±23.6 °C |
| Exact Mass | 432.214813 |
| PSA | 106.97000 |
| LogP | 5.67 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | DPCAYMPTUWTOLE-AQICYYNMSA-N |
| SMILES | CC(=O)OCC(C)C1=C(O)C2=C(C(=O)C1=O)C1(C)CCCC(C)(C)C1CC2OC(C)=O |
| (7α)-12-Hydroxy-11,14-dioxoabieta-8,12-diene-7,16-diyl diacetate |
| 1,4-Phenanthrenedione, 10-(acetyloxy)-2-[2-(acetyloxy)-1-methylethyl]-4b,5,6,7,8,8a,9,10-octahydro-3-hydroxy-4b,8,8-trimethyl-, (4bS,8aS,10R)- |