5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin structure
|
Common Name | 5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin | ||
|---|---|---|---|---|
| CAS Number | 2669-65-0 | Molecular Weight | 616.752 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H32N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C44H32N4 |
| Molecular Weight | 616.752 |
| Exact Mass | 616.262695 |
| PSA | 52.54000 |
| LogP | 7.94 |
| Index of Refraction | 1.704 |
| Hazard Codes | Xn |
|---|
|
~%
5,10,15,20-tetr... CAS#:2669-65-0 |
| Literature: Ball; Dorough; Calvin Journal of the American Chemical Society, 1946 , vol. 68, p. 2278 |
|
~%
5,10,15,20-tetr... CAS#:2669-65-0 |
| Literature: Ball; Dorough; Calvin Journal of the American Chemical Society, 1946 , vol. 68, p. 2278 |
|
~%
5,10,15,20-tetr... CAS#:2669-65-0 |
| Literature: Abraham, Raymond J.; Bedford, Geoffrey R.; McNeillie, David; Wright, Brian Organic Magnetic Resonance, 1980 , vol. 14, # 5 p. 418 - 425 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5,10,15,20-Tetraphenyl-1,2-dihydroporphyrin |
| 21H,23H-Porphine, 7,8-dihydro-5,10,15,20-tetraphenyl- |
| Tetraphenylchlorin |
| DZHWYXCUXNAHCI-LWQDQPMZSA |
| 21H,23H-Porphine, 1,2-dihydro-5,10,15,20-tetraphenyl- |
| meso-Tetraphenylchlorin |
| 5,10,15,20-Tetraphenyl-2,3-dihydroporphyrin |
| 5,10,15,20-tetraphenyl-2,3-dihydro-21H,23H-porphine |
| 21H,23H-Porphine,7,8-dihydro-5,10,15,20-tetraphenyl |
| InChI=1/C44H32N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-25,27,46-47H,26,28H2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44 |
| 5,10,15,20-tetraphenyl-2,3-dihydro-porphyrin |
| T1358 |