3,5-Hexadien-2-one,1-chloro-6-(4-nitrophenyl)- structure
|
Common Name | 3,5-Hexadien-2-one,1-chloro-6-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2664-50-8 | Molecular Weight | 251.66600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3E,5E)-1-chloro-6-(4-nitrophenyl)hexa-3,5-dien-2-one |
|---|
| Molecular Formula | C12H10ClNO3 |
|---|---|
| Molecular Weight | 251.66600 |
| Exact Mass | 251.03500 |
| PSA | 62.89000 |
| LogP | 3.49530 |
| InChIKey | YEDZPDYWQAEJEB-ZPUQHVIOSA-N |
| SMILES | O=C(C=CC=Cc1ccc([N+](=O)[O-])cc1)CCl |
|
~%
3,5-Hexadien-2-... CAS#:2664-50-8 |
| Literature: Baker,B.R.; Jordaan,H. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 35 - 41 |
|
~%
3,5-Hexadien-2-... CAS#:2664-50-8 |
| Literature: Baker,B.R.; Jordaan,H. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 35 - 41 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |