3-Buten-2-one,1-chloro-4-(3-nitrophenyl)- structure
|
Common Name | 3-Buten-2-one,1-chloro-4-(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 15473-82-2 | Molecular Weight | 225.62800 | |
| Density | 1.348g/cm3 | Boiling Point | 369ºC at 760 mmHg | |
| Molecular Formula | C10H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177ºC | |
| Name | (E)-1-chloro-4-(3-nitrophenyl)but-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 369ºC at 760 mmHg |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.62800 |
| Flash Point | 177ºC |
| Exact Mass | 225.01900 |
| PSA | 62.89000 |
| LogP | 2.93910 |
| Vapour Pressure | 1.22E-05mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | DAFSFIUMRVWVBV-SNAWJCMRSA-N |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)CCl |
|
~%
3-Buten-2-one,1... CAS#:15473-82-2 |
| Literature: Baker; Ho Journal of pharmaceutical sciences, 1967 , vol. 56, # 1 p. 28 - 32 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Chlor-4-(m-nitrophenyl)-buten-(3)-on-(2) |