1-chloro-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one structure
|
Common Name | 1-chloro-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 88981-43-5 | Molecular Weight | 226.74200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19ClO |
|---|---|
| Molecular Weight | 226.74200 |
| Exact Mass | 226.11200 |
| PSA | 17.07000 |
| LogP | 3.87710 |
| InChIKey | DNFOYTDKFKOKES-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=O)CCl)C(C)(C)CCC1 |
|
~91%
1-chloro-4-(2,6... CAS#:88981-43-5 |
| Literature: Groesbeek, Michel; Smith, Steven O. Journal of Organic Chemistry, 1997 , vol. 62, # 11 p. 3638 - 3641 |
|
~%
1-chloro-4-(2,6... CAS#:88981-43-5 |
| Literature: Vaz, Alfin D. N.; Schoellmann, Guenther Journal of Organic Chemistry, 1984 , vol. 49, # 7 p. 1286 - 1288 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-chloro-4-(2,6,6-trimethylcyclohexenyl)-3-butenoate |
| 3-Buten-2-one,1-chloro-4-(2,6,6-trimethyl-1-cyclohexen-1-yl)-,(E) |