N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate
Modify Date: 2025-08-25 06:19:18
N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate structure
|
Common Name | N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 265651-18-1 | Molecular Weight | 359.20600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16F6N3O3P | Melting Point | 218-221ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [dimethylamino-(2,5-dioxopyrrolidin-1-yl)oxymethylidene]-dimethylazanium,hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 218-221ºC |
|---|---|
| Molecular Formula | C9H16F6N3O3P |
| Molecular Weight | 359.20600 |
| Exact Mass | 359.08300 |
| PSA | 66.45000 |
| LogP | 2.57700 |
| InChIKey | STWZCCVNXFLDDD-UHFFFAOYSA-N |
| SMILES | CN(C)C(ON1C(=O)CCC1=O)=[N+](C)C.F[P-](F)(F)(F)(F)F |
| Storage condition | Store at 0°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
Gd(III)-DOTA-modified sonosensitive liposomes for ultrasound-triggered release and MR imaging.
Nanoscale Res. Lett. 7 , 462, (2012) Ultrasound-sensitive (sonosensitive) liposomes for tumor targeting have been studied in order to increase the antitumor efficacy of drugs and decrease the associated severe side effects. Liposomal con... |
|
|
Knorr, R, et al.
Tetrahedron Lett. 30 , 1927, (1989)
|
|
|
W. Bannwarth, R. Knorr
Tetrahedron Lett. 32 , 1157, (1991)
|
| [Bis(dimethylamino)methylene](2,5-dioxo-1-pyrrolidinyl)oxonium hexafluorophosphate |
| N,N,N′,N′-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate |
| N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium |
| N,N,N’,N’-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate |
| AmbotzRL-1039 |
| (Dimethylamino)[(2,5-dioxo-1-pyrrolidinyl)oxy]-N,N-dimethylmethaniminium hexafluorophosphate |
| N-{(Dimethylamino)[(2,5-dioxopyrrolidin-1-yl)oxy]methylene}-N-methylmethanaminium hexafluorophosphate |
| N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium Hexafluorophosphate |
| MFCD01863753 |
| HSTU |