N-[3-[(2-Cyanoethyl)amino]-4-methoxyphenyl]acetamide structure
|
Common Name | N-[3-[(2-Cyanoethyl)amino]-4-methoxyphenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 26408-28-6 | Molecular Weight | 233.26600 | |
| Density | 1.07 | Boiling Point | 57-59 °C (15 mmHg) | |
| Molecular Formula | C12H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 57°C | |
| Name | N-[3-(2-cyanoethylamino)-4-methoxyphenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07 |
|---|---|
| Boiling Point | 57-59 °C (15 mmHg) |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.26600 |
| Flash Point | 57°C |
| Exact Mass | 233.11600 |
| PSA | 74.15000 |
| LogP | 2.12518 |
| Vapour Pressure | 2.64E-10mmHg at 25°C |
| Index of Refraction | 1.544-1.546 |
| InChIKey | OVTCINJDJPHUBX-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(C)=O)cc1NCCC#N |
| Hazard Codes | T |
|---|---|
| Risk Phrases | R34:Causes burns. R23/25:Toxic by inhalation and if swallowed . R10:Flammable. |
| Safety Phrases | S45-S38-S36/37/39-S28A-S26-S16 |
| RIDADR | 3286 |
| Packaging Group | II |
| Hazard Class | 3 |
| HS Code | 2926909090 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| einecs 247-676-5 |
| MFCD00126955 |