1-(ISOCYANO(TOSYL)METHYL)-2-METHOXYBENZENE structure
|
Common Name | 1-(ISOCYANO(TOSYL)METHYL)-2-METHOXYBENZENE | ||
|---|---|---|---|---|
| CAS Number | 263389-53-3 | Molecular Weight | 301.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15NO3S |
|---|---|
| Molecular Weight | 301.36000 |
| Exact Mass | 301.07700 |
| PSA | 51.75000 |
| LogP | 3.70690 |
| InChIKey | BTXVFJYPHAIAST-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C(c1ccccc1OC)S(=O)(=O)c1ccc(C)cc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2934999090 |
|
~%
1-(ISOCYANO(TOS... CAS#:263389-53-3 |
| Literature: Antuch, Walfrido; Menon, Sanjay; Chen, Quin-Zene; Lu, Yingchun; Sakamuri, Sukumar; Beck, Barbara; Schauer-Vukasinovic, Vesna; Agarwal, Seema; Hess, Sibylle; Doemling, Alexander Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 6 p. 1740 - 1743 |
|
~%
1-(ISOCYANO(TOS... CAS#:263389-53-3 |
| Literature: Antuch, Walfrido; Menon, Sanjay; Chen, Quin-Zene; Lu, Yingchun; Sakamuri, Sukumar; Beck, Barbara; Schauer-Vukasinovic, Vesna; Agarwal, Seema; Hess, Sibylle; Doemling, Alexander Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 6 p. 1740 - 1743 |
|
~%
1-(ISOCYANO(TOS... CAS#:263389-53-3 |
| Literature: Antuch, Walfrido; Menon, Sanjay; Chen, Quin-Zene; Lu, Yingchun; Sakamuri, Sukumar; Beck, Barbara; Schauer-Vukasinovic, Vesna; Agarwal, Seema; Hess, Sibylle; Doemling, Alexander Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 6 p. 1740 - 1743 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Isocyano(2-methoxyphenyl)methyl-4-methylphenyl sulphone |
| (2-methoxyphenyl)tosylmethyl isonitrile |
| -Tosyl-(2-methoxybenzyl)isocyanide |
| a-Tosyl-(2-methoxybenzyl)isocyanide |
| (2-methoxyphenyl)[(4-methylphenyl)sulfonyl]methanisocyanide |
| 1-(isocyano(tosyl)methyl)-2-methoxybenzene |