(1R)-(-)-Menthyl glyoxylate hydrate
Modify Date: 2025-09-03 15:46:11
(1R)-(-)-Menthyl glyoxylate hydrate structure
|
Common Name | (1R)-(-)-Menthyl glyoxylate hydrate | ||
|---|---|---|---|---|
| CAS Number | 26315-61-7 | Molecular Weight | 230.301 | |
| Density | 1,182 g/cm3 | Boiling Point | 95-96°C 0,3mm | |
| Molecular Formula | C12H22O4 | Melting Point | 76-78°C | |
| MSDS | N/A | Flash Point | 95-96°C/0.3mm | |
| Name | (1R)-(-)-Menthyl glyoxylate hydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1,182 g/cm3 |
|---|---|
| Boiling Point | 95-96°C 0,3mm |
| Melting Point | 76-78°C |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.301 |
| Flash Point | 95-96°C/0.3mm |
| Exact Mass | 230.151810 |
| PSA | 52.60000 |
| LogP | 2.12500 |
| Vapour Pressure | 0.00344mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | YNUVAJRGRQBLLB-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C=O)C1 |
| Storage condition | 2-8℃ |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00792503 |
| l-menthyl glyoxylate |
| (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl oxoacetate hydrate (1:1) |
| Acetic acid, 2-oxo-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, hydrate (1:1) |