1,5-Dimethyl-2-nitro-4-(trifluoromethyl)benzene structure
|
Common Name | 1,5-Dimethyl-2-nitro-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 261945-82-8 | Molecular Weight | 219.161 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 236.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H8F3NO2 | Melting Point | 35ºC | |
| MSDS | N/A | Flash Point | 96.7±25.9 °C | |
| Name | 1,5-dimethyl-2-nitro-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 236.2±35.0 °C at 760 mmHg |
| Melting Point | 35ºC |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.161 |
| Flash Point | 96.7±25.9 °C |
| Exact Mass | 219.050720 |
| PSA | 45.82000 |
| LogP | 3.54 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | HMRYPTHOPWUPOB-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(F)(F)F)cc1[N+](=O)[O-] |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1,5-dimethyl-2-nitro-4-(trifluoromethyl)- |
| 2,4-Dimethyl-5-nitrobenzotrifluoride |
| 1,5-Dimethyl-2-nitro-4-(trifluoromethyl)benzene |