2-Thiazolamine,5-[2-(2,6-dimethylphenyl)diazenyl]-4-phenyl- structure
|
Common Name | 2-Thiazolamine,5-[2-(2,6-dimethylphenyl)diazenyl]-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 26179-23-7 | Molecular Weight | 308.40100 | |
| Density | 1.26g/cm3 | Boiling Point | 428.1ºC at 760mmHg | |
| Molecular Formula | C17H16N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.7ºC | |
| Name | N-[(E)-(2-imino-4-phenyl-1,3-thiazol-5-ylidene)amino]-2,6-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 428.1ºC at 760mmHg |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.40100 |
| Flash Point | 212.7ºC |
| Exact Mass | 308.11000 |
| PSA | 91.87000 |
| LogP | 6.00570 |
| Vapour Pressure | 1.55E-07mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | MQCVMQGIYCDXAA-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1N=Nc1sc(N)nc1-c1ccccc1 |
|
~%
2-Thiazolamine,... CAS#:26179-23-7 |
| Literature: Garg; Sharma Journal of pharmaceutical sciences, 1970 , vol. 59, # 3 p. 348 - 353 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-(2,6-dimethyl-phenylazo)-4-phenyl-thiazol-2-ylamine |