2-Thiazolamine,5-[2-(2-methoxyphenyl)diazenyl]-4-phenyl- structure
|
Common Name | 2-Thiazolamine,5-[2-(2-methoxyphenyl)diazenyl]-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 26179-12-4 | Molecular Weight | 310.37400 | |
| Density | 1.31g/cm3 | Boiling Point | 445.2ºC at 760mmHg | |
| Molecular Formula | C16H14N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1ºC | |
| Name | N-[(E)-(2-imino-4-phenyl-1,3-thiazol-5-ylidene)amino]-2-methoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 445.2ºC at 760mmHg |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.37400 |
| Flash Point | 223.1ºC |
| Exact Mass | 310.08900 |
| PSA | 101.10000 |
| LogP | 5.39750 |
| Vapour Pressure | 4.02E-08mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | TVGMBMVVDGXMLQ-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N=Nc1sc(N)nc1-c1ccccc1 |
|
~%
2-Thiazolamine,... CAS#:26179-12-4 |
| Literature: Rao; Khan; Mehra Journal of the Indian Chemical Society, 1982 , vol. 59, # 3 p. 375 - 377 |
|
~%
2-Thiazolamine,... CAS#:26179-12-4 |
| Literature: Rao; Khan; Mehra Journal of the Indian Chemical Society, 1982 , vol. 59, # 3 p. 375 - 377 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 5-(2-methoxy-phenylazo)-4-phenyl-thiazol-2-ylamine |
| 5-(2'-methoxy-phenylazo)-2-amino-4-phenyl-thiazole |