N-(tert-Butoxycarbonyl)-3-methoxy-D-phenylalanine structure
|
Common Name | N-(tert-Butoxycarbonyl)-3-methoxy-D-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 261380-37-4 | Molecular Weight | 295.331 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 461.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.0±27.3 °C | |
| Name | (2R)-3-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.7±40.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.331 |
| Flash Point | 233.0±27.3 °C |
| Exact Mass | 295.141968 |
| PSA | 84.86000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | GOHDMZILHKRUGN-GFCCVEGCSA-N |
| SMILES | COc1cccc(CC(NC(=O)OC(C)(C)C)C(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| BOC-D-3-MEO-PHE-OH |
| 3-Methoxy-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine |
| N-(tert-Butoxycarbonyl)-3-methoxy-D-phenylalanine |
| Boc-3-Methoxy-D-phenylalanine |
| D-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-3-methoxy- |