Picrasin B
Modify Date: 2025-08-24 21:51:43
Picrasin B structure
|
Common Name | Picrasin B | ||
|---|---|---|---|---|
| CAS Number | 26121-56-2 | Molecular Weight | 376.443 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 584.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3±23.6 °C | |
Use of Picrasin BPicrasin B (Nigakilactone I) can be isolated from the bark of Picrasma quassioides. Picrasin B shows antifeedant and insecticidal activity against Diamondback Moth[1]. |
| Name | Picrasin B |
|---|---|
| Synonym | More Synonyms |
| Description | Picrasin B (Nigakilactone I) can be isolated from the bark of Picrasma quassioides. Picrasin B shows antifeedant and insecticidal activity against Diamondback Moth[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 584.3±50.0 °C at 760 mmHg |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.443 |
| Flash Point | 205.3±23.6 °C |
| Exact Mass | 376.188599 |
| PSA | 89.90000 |
| LogP | 1.11 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | GESOKLRVLMVNMO-FIFUNIKPSA-N |
| SMILES | COC1=C(C)C2CC(=O)OC3CC4C(C)CC(O)C(=O)C4(C)C(C1=O)C32C |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:26121-57-3
CAS#:30315-04-9| Picras-12-ene-1,11,16-trione, 2-hydroxy-12-methoxy-, (2α)- |
| (2α)-2-Hydroxy-12-methoxypicras-12-ene-1,11,16-trione |