Enecadin
Modify Date: 2025-08-25 12:06:03
Enecadin structure
|
Common Name | Enecadin | ||
|---|---|---|---|---|
| CAS Number | 259525-01-4 | Molecular Weight | 357.46 | |
| Density | 1.099g/cm3 | Boiling Point | 487.7ºC at 760mmHg | |
| Molecular Formula | C21H28FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.8ºC | |
Use of EnecadinEnecadin is a neuroprotective agent extracted from patent US 8623823 B2. |
| Name | 4-(4-fluorophenyl)-2-methyl-6-(5-piperidin-1-ylpentoxy)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Description | Enecadin is a neuroprotective agent extracted from patent US 8623823 B2. |
|---|---|
| Related Catalog | |
| In Vitro | Enecadin is a neuroprotective agent which can be useful for the treatment of stroke or other cerebrovascular accident[1]. |
| References |
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 487.7ºC at 760mmHg |
| Molecular Formula | C21H28FN3O |
| Molecular Weight | 357.46 |
| Flash Point | 248.8ºC |
| PSA | 117.27000 |
| LogP | 0.00330 |
| Vapour Pressure | 1.16E-09mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | SZSHJTJCJOWMHM-UHFFFAOYSA-N |
| SMILES | Cc1nc(OCCCCCN2CCCCC2)cc(-c2ccc(F)cc2)n1 |
| Storage condition | 2-8℃ |
| Enecadine |
| Enecadina |
| Enecadin |
| UNII-VR034VW8OG |