2-(Ethylthio)-3-methyl-1,4-naphthoquinone structure
|
Common Name | 2-(Ethylthio)-3-methyl-1,4-naphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 2593-56-8 | Molecular Weight | 232.29800 | |
| Density | 1.24g/cm3 | Boiling Point | 368.2ºC at 760mmHg | |
| Molecular Formula | C13H12O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | 2-(Ethylthio)-3-methyl-1,4-naphthoquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 368.2ºC at 760mmHg |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.29800 |
| Flash Point | 160ºC |
| Exact Mass | 232.05600 |
| PSA | 59.44000 |
| LogP | 3.09270 |
| Vapour Pressure | 1.3E-05mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | AAPLOQZFUUYECE-UHFFFAOYSA-N |
| SMILES | CCSC1=C(C)C(=O)c2ccccc2C1=O |
| HS Code | 2930909090 |
|---|
|
~%
2-(Ethylthio)-3... CAS#:2593-56-8 |
| Literature: Fieser; Brown Journal of the American Chemical Society, 1949 , vol. 71, p. 3615 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Aethylmercapto-3-methyl-[1,4]naphthochinon |
| 2-ethylsulfanyl-3-methyl-[1,4]naphthoquinone |