Dehydronandrolon structure
|
Common Name | Dehydronandrolon | ||
|---|---|---|---|---|
| CAS Number | 2590-41-2 | Molecular Weight | 314.419 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 457.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H26O3 | Melting Point | -80 °C | |
| MSDS | N/A | Flash Point | 200.6±28.8 °C | |
| Name | 6-Dehydro Nandrolone Acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 457.4±45.0 °C at 760 mmHg |
| Melting Point | -80 °C |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.419 |
| Flash Point | 200.6±28.8 °C |
| Exact Mass | 314.188202 |
| PSA | 43.37000 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | OGUASZAAVFYYIL-XGXHKTLJSA-N |
| SMILES | CC(=O)OC1CCC2C3C=CC4=CC(=O)CCC4C3CCC12C |
| Storage condition | Controlled Substance, -20?C Freezer |
| Water Solubility | 17 g/L (20 ºC) |
| Hazard Codes | C,Xn,F |
|---|---|
| Risk Phrases | R10:Flammable. R22:Harmful if swallowed. R34:Causes burns. R52/53:Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment . R36/37/38:Irritating to eyes, respiratory system and skin . R36:Irritating to the eyes. |
| Safety Phrases | S16-S26-S36/37/39-S45-S61-S37/39 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 2 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2914400090 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Dehydronandrolon |
| (17β)-3-Oxoestra-4,6-dien-17-yl acetate |
| Estra-4,6-dien-3-one, 17-(acetyloxy)-, (17β)- |
| MFCD00271529 |