2-Propen-1-one,1-(4-aminophenyl)-3-(4-methoxyphenyl)-
Modify Date: 2025-08-29 11:50:04
2-Propen-1-one,1-(4-aminophenyl)-3-(4-methoxyphenyl)- structure
|
Common Name | 2-Propen-1-one,1-(4-aminophenyl)-3-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 25870-73-9 | Molecular Weight | 253.29600 | |
| Density | 1.172g/cm3 | Boiling Point | 471.5ºC at 760mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.1ºC | |
| Name | (2E)-1-(4-Aminophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 471.5ºC at 760mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 232.1ºC |
| Exact Mass | 253.11000 |
| PSA | 52.32000 |
| LogP | 3.75470 |
| Vapour Pressure | 4.64E-09mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | QIFZZXZSSXRDOT-NYYWCZLTSA-N |
| SMILES | COc1ccc(C=CC(=O)c2ccc(N)cc2)cc1 |
| HS Code | 2922509090 |
|---|
CAS#:123-11-5
CAS#:99-92-3
CAS#:6552-62-1![N-[4-[3-(4-methoxyphenyl)prop-2-enoyl]phenyl]acetamide structure](https://image.chemsrc.com/caspic/404/85791-65-7.png)
CAS#:85791-65-7| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-methoxy-4'-amino-chalcone |
| 4'-amino-4-methoxy-chalcone |
| 1-(4-aminophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| 4'-Amino-4-methoxy-chalkon |