dibenzyl chloromethyl phosphate structure
|
Common Name | dibenzyl chloromethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 258516-84-6 | Molecular Weight | 326.71200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16ClO4P | Melting Point | N/A | |
| MSDS | USA | Flash Point | 346 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | dibenzyl chloromethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16ClO4P |
|---|---|
| Molecular Weight | 326.71200 |
| Flash Point | 346 °C |
| Exact Mass | 326.04700 |
| PSA | 54.57000 |
| LogP | 4.74100 |
| InChIKey | FVTHQGOGQRTOMY-UHFFFAOYSA-N |
| SMILES | O=P(OCCl)(OCc1ccccc1)OCc1ccccc1 |
| Storage condition | ?20°C |
|
~43%
dibenzyl chloro... CAS#:258516-84-6 |
| Literature: WO2008/14602 A1, ; Page/Page column 56-58 ; |
|
~91%
dibenzyl chloro... CAS#:258516-84-6 |
| Literature: Tetrahedron Letters, , vol. 43, # 21 p. 3793 - 3794 |
|
~66%
dibenzyl chloro... CAS#:258516-84-6 |
| Literature: Journal of the American Chemical Society, , vol. 133, # 31 p. 12021 - 12030 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
A novel synthetic route for the preparation of alkyl and benzyl chloromethyl phosphates Mäntylä, A., et al.
Tetrahedron Lett. 43(21) , 3793-3794, (2002)
|
| dibenzyl (chloromethyl) phosphate |