4-methoxynitracrine structure
|
Common Name | 4-methoxynitracrine | ||
|---|---|---|---|---|
| CAS Number | 25799-70-6 | Molecular Weight | 354.40300 | |
| Density | 1.268g/cm3 | Boiling Point | 564.7ºC at 760 mmHg | |
| Molecular Formula | C19H22N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.3ºC | |
| Name | N-(4-methoxy-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 564.7ºC at 760 mmHg |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.40300 |
| Flash Point | 295.3ºC |
| Exact Mass | 354.16900 |
| PSA | 86.44000 |
| LogP | 3.61350 |
| Vapour Pressure | 8.96E-13mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | FECAGPZNMVGWPG-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c2c(NCCCN(C)C)c3ccccc3nc12 |
|
~%
4-methoxynitracrine CAS#:25799-70-6 |
| Literature: Lee; Wilson; Ferry; Van Zijl; Pullen; Denny Journal of Medicinal Chemistry, 1996 , vol. 39, # 13 p. 2508 - 2517 |
|
~%
4-methoxynitracrine CAS#:25799-70-6 |
| Literature: Wilson; Anderson; Denny Journal of Medicinal Chemistry, 1989 , vol. 32, # 1 p. 23 - 30 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,3-Propanediamine,N,N-dimethyl-N'-(4-methoxy-1-nitro-9-acridinyl) |
| 9-((3-(Dimethylamino)propyl)amino)-4-methoxy-1-nitroacridine |
| 4-methoxy-9-<<3-(dimethylamino)propyl>amino>-1-nitroacridine |
| N,N-Dimethyl-N'-(4-methoxy-1-nitro-9-acridinyl)-1,3-propanediamine |
| 1-Nitro-4-methoxy-9-(3-dimethylamino-propylamino)-acridin |
| 4-Methoxynitracrine |
| N'-(4-Methoxy-1-nitro-9-acridinyl)-N,N-dimethyl-1,3-propanediamine |