4-Chloro-3-(trifluoromethyl)cinnamic acid
Modify Date: 2025-08-25 21:27:49
4-Chloro-3-(trifluoromethyl)cinnamic acid structure
|
Common Name | 4-Chloro-3-(trifluoromethyl)cinnamic acid | ||
|---|---|---|---|---|
| CAS Number | 257872-87-0 | Molecular Weight | 250.602 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 335.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H6ClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6±26.5 °C | |
| Name | 4-Chloro-3-(trifluoromethyl)cinnamic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.3±37.0 °C at 760 mmHg |
| Molecular Formula | C10H6ClF3O2 |
| Molecular Weight | 250.602 |
| Flash Point | 156.6±26.5 °C |
| Exact Mass | 250.000839 |
| PSA | 37.30000 |
| LogP | 3.93 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | LFYBNFKZUWTBMM-DUXPYHPUSA-N |
| SMILES | O=C(O)C=Cc1ccc(Cl)c(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Propenoic acid, 3-[4-chloro-3-(trifluoromethyl)phenyl]-, (2E)- |
| (E)-3-[4-Chloro-3-(trifluoromethyl)phenyl]acrylic acid |
| QV1U1R DG CXFFF &&trans or E Form |
| 4-chloro-3-trifluoromethyl cinnamic acid |
| (2E)-3-[4-Chloro-3-(trifluoromethyl)phenyl]-2-propenoic acid |
| (2E)-3-[4-Chloro-3-(trifluoromethyl)phenyl]acrylic acid |
| (E)-3-[4-Chloro-3-(trifluoromethyl)phenyl]prop-2-enoic acid |