2-Chloro-5-nitrobenzoyl chloride structure
|
Common Name | 2-Chloro-5-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 25784-91-2 | Molecular Weight | 220.010 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 307.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H3Cl2NO3 | Melting Point | 58-60°C | |
| MSDS | USA | Flash Point | 140.0±22.3 °C | |
| Name | 2-Chloro-5-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.9±22.0 °C at 760 mmHg |
| Melting Point | 58-60°C |
| Molecular Formula | C7H3Cl2NO3 |
| Molecular Weight | 220.010 |
| Flash Point | 140.0±22.3 °C |
| Exact Mass | 218.949005 |
| PSA | 62.89000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | OGLKKYALUKXVPQ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cc([N+](=O)[O-])ccc1Cl |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34:Causes burns. |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3261 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2916399090 |
|
~99%
2-Chloro-5-nitr... CAS#:25784-91-2 |
| Literature: CELL THERAPEUTICS, INC. Patent: US2002/107269 A1, 2002 ; |
|
~%
2-Chloro-5-nitr... CAS#:25784-91-2 |
| Literature: US2003/153570 A1, ; |
|
~%
2-Chloro-5-nitr... CAS#:25784-91-2 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 19, p. 55 |
|
~%
2-Chloro-5-nitr... CAS#:25784-91-2 |
| Literature: Journal of the Indian Chemical Society, , vol. 10, p. 353,357 |
|
~%
2-Chloro-5-nitr... CAS#:25784-91-2 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 19, p. 55 |
|
~%
2-Chloro-5-nitr... CAS#:25784-91-2 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 19, p. 55 |
|
~%
2-Chloro-5-nitr... CAS#:25784-91-2 |
| Literature: Journal of the Indian Chemical Society, , vol. 10, p. 353,357 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00059180 |
| 2-Chloro-5-nitrobenzoyl chloride |
| Benzoyl chloride, 2-chloro-5-nitro- |
| 2-Chloro-5-nitrobenzoylchloride |
| EINECS 247-262-4 |
| 3-nitro-6-chloro-benzoylchloride |
| 2-Chlor-5-nitro-benzoylchlorid |
| Benzoyl chloride,2-chloro-5-nitro |