[2-(diethylcarbamoyloxymethyl)-2-ethylbutyl] N,N-diethylcarbamate
Modify Date: 2025-08-27 18:02:41
![[2-(diethylcarbamoyloxymethyl)-2-ethylbutyl] N,N-diethylcarbamate Structure](https://image.chemsrc.com/caspic/406/25648-90-2.png)
[2-(diethylcarbamoyloxymethyl)-2-ethylbutyl] N,N-diethylcarbamate structure
|
Common Name | [2-(diethylcarbamoyloxymethyl)-2-ethylbutyl] N,N-diethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 25648-90-2 | Molecular Weight | 330.46300 | |
| Density | 0.999g/cm3 | Boiling Point | 412.1ºC at 760mmHg | |
| Molecular Formula | C17H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203ºC | |
| Name | [2-(diethylcarbamoyloxymethyl)-2-ethylbutyl] N,N-diethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999g/cm3 |
|---|---|
| Boiling Point | 412.1ºC at 760mmHg |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.46300 |
| Flash Point | 203ºC |
| Exact Mass | 330.25200 |
| PSA | 59.08000 |
| LogP | 3.74960 |
| Vapour Pressure | 5.31E-07mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | SNUBBWAURMSPJZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)OCC(CC)(CC)COC(=O)N(CC)CC |
|
~%
[2-(diethylcarb... CAS#:25648-90-2 |
| Literature: Ludwig; Piech Journal of the American Chemical Society, 1951 , vol. 73, p. 5779 |
|
~%
[2-(diethylcarb... CAS#:25648-90-2 |
| Literature: Ludwig,B.J. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 3 p. 462 - 472 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,3-Bis-diaethylcarbamoyloxymethyl-pentan |
| 2,2-Diaethyl-1,3-bis-diaethylcarbamoyloxy-propan |
| N.N.N'.N'.2.2-Hexaethyl-1.3-dicarbamoyloxy-propan |
| 4,4-Diaethyl-2,6-dioxa-heptandisaeure-bis-diaethylamid |
| 4,4-diethyl-2,6-dioxa-heptanedioic acid bis-diethylamide |
| 1,3-Propanediol,2,2-diethyl-,bis(diethylcarbamate) |
| 2,2-Diethyl-1,3-propanediol bis(diethylcarbamate) |