[1,1'-Binaphthalen]-2-yldi-tert-butylphosphine structure
|
Common Name | [1,1'-Binaphthalen]-2-yldi-tert-butylphosphine | ||
|---|---|---|---|---|
| CAS Number | 255836-67-0 | Molecular Weight | 398.520 | |
| Density | N/A | Boiling Point | 519.5±29.0 °C at 760 mmHg | |
| Molecular Formula | C28H31P | Melting Point | 148-151ºC | |
| MSDS | Chinese USA | Flash Point | 284.8±30.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ditert-butyl-(1-naphthalen-1-ylnaphthalen-2-yl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 519.5±29.0 °C at 760 mmHg |
|---|---|
| Melting Point | 148-151ºC |
| Molecular Formula | C28H31P |
| Molecular Weight | 398.520 |
| Flash Point | 284.8±30.6 °C |
| Exact Mass | 398.216339 |
| PSA | 13.59000 |
| LogP | 9.24 |
| Appearance of Characters | crystal | white |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| InChIKey | QGBQGMHXBSLYLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(c1ccc2ccccc2c1-c1cccc2ccccc12)C(C)(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 37/39-26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2902909090 |
|
~32%
[1,1'-Binaphtha... CAS#:255836-67-0 |
| Literature: Toracca, Karen E.; Kuwabe, Shin-Itsu; Buchwald, Stephen L. Journal of the American Chemical Society, 2000 , vol. 122, # 51 p. 12907 - 12908 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| racemic 2-(ditert-butylphosphino )-1,1'-binapthyl |
| racemic-2-Di-t-butylphosphino-1,1'-binaphthyl |
| 2-(Di-tert-butylphosphino)-1,1′-binaphthyl |
| TRIXIEPHOS |
| 2-(Di-tert-butylphosphino)-1,1‘-binaphthyl |
| rac-2-(Di-tert-butylphosphino)-1,1'-binaphthyl |
| 1,1'-Binaphthalen-2-yl[bis(2-methyl-2-propanyl)]phosphine |
| 2-[Di(tert-butyl)phosphino]-1,1'-binaphthyl |
| racemic-2-(di-tert-butylphosphino)-1,1'-binaphthyl |
| 2-(di-t-butylphosphino)-1,1'-binaphthyl |
| Phosphine, [1,1'-binaphthalen]-2-ylbis(1,1-dimethylethyl)- |
| [1,1'-Binaphthalen]-2-yldi-tert-butylphosphine |
| (binaphthyl)P(t-Bu)2 |