4-(1-Piperazinyl)-1H-indole dihydrochloride structure
|
Common Name | 4-(1-Piperazinyl)-1H-indole dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 255714-24-0 | Molecular Weight | 274.190 | |
| Density | 1.182g/cm3 | Boiling Point | 421.5ºC at 760 mmHg | |
| Molecular Formula | C12H17Cl2N3 | Melting Point | 300-303ºC | |
| MSDS | Chinese USA | Flash Point | 208.7ºC | |
| Name | 4-piperazin-1-yl-1H-indole,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 421.5ºC at 760 mmHg |
| Melting Point | 300-303ºC |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.190 |
| Flash Point | 208.7ºC |
| Exact Mass | 273.079956 |
| PSA | 31.06000 |
| LogP | 3.57530 |
| Vapour Pressure | 2.59E-07mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | FHRAUNYCUBSDMF-UHFFFAOYSA-N |
| SMILES | Cl.Cl.c1cc(N2CCNCC2)c2cc[nH]c2c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole, 4-(1-piperazinyl)-, hydrochloride (1:2) |
| 4-Piperazinoindole dihydrochloride |
| 4-(Piperazin-1-yl)-1H-indole dihydrochloride |
| 4-(1-Piperazinyl)-1H-indole dihydrochloride |