6-Methyl-2-(trifluoromethyl)pyrimidin-4-ol structure
|
Common Name | 6-Methyl-2-(trifluoromethyl)pyrimidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 2557-79-1 | Molecular Weight | 178.112 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 148.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C6H5F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 43.7±30.1 °C | |
| Name | 6-methyl-2-(trifluoromethyl)-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 148.6±50.0 °C at 760 mmHg |
| Molecular Formula | C6H5F3N2O |
| Molecular Weight | 178.112 |
| Flash Point | 43.7±30.1 °C |
| Exact Mass | 178.035400 |
| PSA | 46.01000 |
| LogP | 1.34 |
| Vapour Pressure | 4.2±0.3 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | UCULFLJNPKTZFE-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)[nH]c(C(F)(F)F)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Methyl-2-(trifluoromethyl)-4(1H)-pyrimidinone |
| 6-methyl-2-(trifluoromethyl)pyrimidin-4-ol |
| 6-methyl-2-trifluoromethyl-3H-pyrimidin-4-one |
| 6-Methyl-2-(trifluoromethyl)pyrimidin-4(3H)-one |
| 4-pyrimidinol, 6-methyl-2-(trifluoromethyl)- |
| 4(1H)-Pyrimidinone, 6-methyl-2-(trifluoromethyl)- |
| 4-Hydroxy-6-methyl-2-trifluormethyl-pyrimidin |
| 6-methyl-2-trifluoromethyl-4-pyrimidinol |
| 4-hydroxy-6-methyl-2-trifluoromethyl-pyrimidine |