4-(2-Nitroanilino)-pyridine structure
|
Common Name | 4-(2-Nitroanilino)-pyridine | ||
|---|---|---|---|---|
| CAS Number | 25551-59-1 | Molecular Weight | 215.20800 | |
| Density | 1.34g/cm3 | Boiling Point | 379.9ºC at 760mmHg | |
| Molecular Formula | C11H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | N-(2-nitrophenyl)pyridin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 379.9ºC at 760mmHg |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.20800 |
| Flash Point | 183.5ºC |
| Exact Mass | 215.06900 |
| PSA | 70.74000 |
| LogP | 3.32960 |
| Vapour Pressure | 5.68E-06mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | VHQUELUASRQSPI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1Nc1ccncc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
|
~18%
4-(2-Nitroanili... CAS#:25551-59-1 |
| Literature: Schliemann; Buge Pharmazie, 1980 , vol. 35, # 4 p. 203 - 204 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[(2-Nitrophenyl)amino]pyridine |
| 4-(2'-Nitroanilino)-pyridin |
| (2-nitro-phenyl)-pyridin-4-yl-amine |
| N-(2-nitrophenyl)-4-pyridinamine |
| 2-Nitro-N-(4'-pyridyl)aniline |
| 4-(2-Nitroanilino)pyridine |
| 4-(o-Nitroanilino)-pyridin |
| 4-(2-Nitroanilino)-pyridine |